C19H16FN3O2S — CID 46518220
5-(4-fluorophenyl)-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide (PubChem CID 46518220) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46518220 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[4-(methylcarbamoylamino)phenyl]thiophene-2-carboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2ccc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C19H16FN3O2S/c1-21-19(25)23-15-8-6-14(7-9-15)22-18(24)17-11-10-16(26-17)12-2-4-13(20)5-3-12/h2-11H,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | DVCYNHRPJQNORS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |