C17H13NOS — CID 3746437
N,5-diphenylthiophene-2-carboxamide (PubChem CID 3746437) has the molecular formula C17H13NOS and a molecular weight of 279.36 g/mol. Its IUPAC name is N,5-diphenylthiophene-2-carboxamide.
| Compound Name | N,5-diphenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 3746437 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N,5-diphenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H13NOS/c19-17(18-14-9-5-2-6-10-14)16-12-11-15(20-16)13-7-3-1-4-8-13/h1-12H,(H,18,19) |
| InChIKey | SKWHGPNGGBOHLW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |