C23H22N2O2S — CID 70036807
N-[4-[5-(piperidine-1-carbonyl)thiophen-2-yl]phenyl]benzamide (PubChem CID 70036807) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-[5-(piperidine-1-carbonyl)thiophen-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[5-(piperidine-1-carbonyl)thiophen-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 70036807 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[4-[5-(piperidine-1-carbonyl)thiophen-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(C(=O)N3CCCCC3)s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O2S/c26-22(18-7-3-1-4-8-18)24-19-11-9-17(10-12-19)20-13-14-21(28-20)23(27)25-15-5-2-6-16-25/h1,3-4,7-14H,2,5-6,15-16H2,(H,24,26) |
| InChIKey | NZXOWIXBGLQEAH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |