C17H16BrNO3S — CID 7712603
[2-(2,5-dimethylanilino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712603) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712603 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(C)c(NC(=O)COC(=O)/C=C/c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C17H16BrNO3S/c1-11-3-4-12(2)14(9-11)19-16(20)10-22-17(21)8-6-13-5-7-15(18)23-13/h3-9H,10H2,1-2H3,(H,19,20)/b8-6+ |
| InChIKey | BSSWKCNBQDKSFY-SOFGYWHQSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|