C10H9BrN2O4S — CID 7712524
[2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712524) has the molecular formula C10H9BrN2O4S and a molecular weight of 333.16 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712524 |
| Molecular Formula | C10H9BrN2O4S |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | NC(=O)NC(=O)COC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C10H9BrN2O4S/c11-7-3-1-6(18-7)2-4-9(15)17-5-8(14)13-10(12)16/h1-4H,5H2,(H3,12,13,14,16)/b4-2+ |
| InChIKey | BRJYYZMTVFYDEZ-DUXPYHPUSA-N |
| XLogP | 1.26 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|