C17H13BrN2O3S — CID 9059056
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 9059056) has the molecular formula C17H13BrN2O3S and a molecular weight of 405.27 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9059056 |
| Molecular Formula | C17H13BrN2O3S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)/C=C/c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C17H13BrN2O3S/c18-15-7-5-14(24-15)6-8-17(22)23-11-16(21)20-13-3-1-12(2-4-13)9-10-19/h1-8H,9,11H2,(H,20,21)/b8-6+ |
| InChIKey | QOEKWBGVRNXUKG-SOFGYWHQSA-N |
| XLogP | 3.77 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|