C18H19BrN3OS+ — CID 9055774
(5-bromothiophen-2-yl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-prop-2-enylazanium (PubChem CID 9055774) has the molecular formula C18H19BrN3OS+ and a molecular weight of 405.34 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-prop-2-enylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9055774 |
| Molecular Formula | C18H19BrN3OS+ |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)Nc1ccc(CC#N)cc1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C18H18BrN3OS/c1-2-11-22(12-16-7-8-17(19)24-16)13-18(23)21-15-5-3-14(4-6-15)9-10-20/h2-8H,1,9,11-13H2,(H,21,23)/p+1 |
| InChIKey | OVOCDSMAEPMZEB-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|