C17H20BrN2O2S+ — CID 9299824
(5-bromothiophen-2-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-prop-2-enylazanium (PubChem CID 9299824) has the molecular formula C17H20BrN2O2S+ and a molecular weight of 396.33 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-prop-2-enylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9299824 |
| Molecular Formula | C17H20BrN2O2S+ |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)Nc1cccc(OC)c1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C17H19BrN2O2S/c1-3-9-20(11-15-7-8-16(18)23-15)12-17(21)19-13-5-4-6-14(10-13)22-2/h3-8,10H,1,9,11-12H2,2H3,(H,19,21)/p+1 |
| InChIKey | QOSKDAZCJWGXJM-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|