C17H19BrN2O2S — CID 9299825
2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 9299825) has the molecular formula C17H19BrN2O2S and a molecular weight of 395.32 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9299825 |
| Molecular Formula | C17H19BrN2O2S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1cccc(OC)c1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C17H19BrN2O2S/c1-3-9-20(11-15-7-8-16(18)23-15)12-17(21)19-13-5-4-6-14(10-13)22-2/h3-8,10H,1,9,11-12H2,2H3,(H,19,21) |
| InChIKey | QOSKDAZCJWGXJM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|