C19H23BrN2OS — CID 9299712
2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 9299712) has the molecular formula C19H23BrN2OS and a molecular weight of 407.38 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9299712 |
| Molecular Formula | C19H23BrN2OS |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-prop-2-enylamino]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1c(C)cccc1CC)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C19H23BrN2OS/c1-4-11-22(12-16-9-10-17(20)24-16)13-18(23)21-19-14(3)7-6-8-15(19)5-2/h4,6-10H,1,5,11-13H2,2-3H3,(H,21,23) |
| InChIKey | CSYPIINWRQOGPA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|