C21H26ClN3O2S — CID 8694053
3-[[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 8694053) has the molecular formula C21H26ClN3O2S and a molecular weight of 419.98 g/mol. Its IUPAC name is 3-[[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 8694053 |
| Molecular Formula | C21H26ClN3O2S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[[2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | C=CCN(CC(=O)Nc1cccc(C(=O)N(CC)CC)c1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C21H26ClN3O2S/c1-4-12-24(14-18-10-11-19(22)28-18)15-20(26)23-17-9-7-8-16(13-17)21(27)25(5-2)6-3/h4,7-11,13H,1,5-6,12,14-15H2,2-3H3,(H,23,26) |
| InChIKey | JPEPDRASXWMFGQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|