C18H21ClN2OS — CID 9298310
2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 9298310) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9298310 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C=CCN(CC(=O)N[C@H](C)c1ccccc1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H21ClN2OS/c1-3-11-21(12-16-9-10-17(19)23-16)13-18(22)20-14(2)15-7-5-4-6-8-15/h3-10,14H,1,11-13H2,2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | MWKQRTMBQVKBEM-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|