C21H23ClN4O3S — CID 55411654
2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 55411654) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55411654 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]-N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | C=CCN(CC(=O)NN1C(=O)NC(CC)(c2ccccc2)C1=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-3-12-25(13-16-10-11-17(22)30-16)14-18(27)24-26-19(28)21(4-2,23-20(26)29)15-8-6-5-7-9-15/h3,5-11H,1,4,12-14H2,2H3,(H,23,29)(H,24,27) |
| InChIKey | KWYDGEXAQMPJDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|