C20H23ClN3O2S+ — CID 9172087
(5-chlorothiophen-2-yl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-prop-2-enylazanium (PubChem CID 9172087) has the molecular formula C20H23ClN3O2S+ and a molecular weight of 404.94 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9172087 |
| Molecular Formula | C20H23ClN3O2S+ |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](Cc1ccc(Cl)s1)CN1C(=O)N[C@](CC)(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H22ClN3O2S/c1-3-12-23(13-16-10-11-17(21)27-16)14-24-18(25)20(4-2,22-19(24)26)15-8-6-5-7-9-15/h3,5-11H,1,4,12-14H2,2H3,(H,22,26)/p+1/t20-/m1/s1 |
| InChIKey | BYEWNVRHIBFRCM-HXUWFJFHSA-O |
| XLogP | 2.79 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|