C18H25ClN3O2S+ — CID 9172066
(5-chlorothiophen-2-yl)methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-prop-2-enylazanium (PubChem CID 9172066) has the molecular formula C18H25ClN3O2S+ and a molecular weight of 382.94 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9172066 |
| Molecular Formula | C18H25ClN3O2S+ |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](Cc1ccc(Cl)s1)CN1C(=O)NC2(CCC(C)CC2)C1=O |
| InChI | InChI=1S/C18H24ClN3O2S/c1-3-10-21(11-14-4-5-15(19)25-14)12-22-16(23)18(20-17(22)24)8-6-13(2)7-9-18/h3-5,13H,1,6-12H2,2H3,(H,20,24)/p+1 |
| InChIKey | CWQLWILSVJPUMF-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|