C14H21BrN2O2 — CID 65008305
3-[[1-(bromomethyl)cyclopropyl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 65008305) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 3-[[1-(bromomethyl)cyclopropyl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[1-(bromomethyl)cyclopropyl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 65008305 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-[[1-(bromomethyl)cyclopropyl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC1(CBr)CC1)C2=O |
| InChI | InChI=1S/C14H21BrN2O2/c1-10-2-4-14(5-3-10)11(18)17(12(19)16-14)9-13(8-15)6-7-13/h10H,2-9H2,1H3,(H,16,19) |
| InChIKey | FTIJWJPZFZUXBB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|