C17H30N3O2+ — CID 8000634
3-[[(2S,6R)-2,6-dimethylpiperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 8000634) has the molecular formula C17H30N3O2+ and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[[(2S,6R)-2,6-dimethylpiperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(2S,6R)-2,6-dimethylpiperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 8000634 |
| Molecular Formula | C17H30N3O2+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 3-[[(2S,6R)-2,6-dimethylpiperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(C[NH+]1[C@H](C)CCC[C@@H]1C)C2=O |
| InChI | InChI=1S/C17H29N3O2/c1-12-7-9-17(10-8-12)15(21)20(16(22)18-17)11-19-13(2)5-4-6-14(19)3/h12-14H,4-11H2,1-3H3,(H,18,22)/p+1/t12?,13-,14+,17? |
| InChIKey | FANBLNSUURMZTO-GCGBMVOASA-O |
| XLogP | 1.29 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|