C18H26N3O2S+ — CID 9321197
8-methyl-3-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9321197) has the molecular formula C18H26N3O2S+ and a molecular weight of 348.49 g/mol. Its IUPAC name is 8-methyl-3-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9321197 |
| Molecular Formula | C18H26N3O2S+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 8-methyl-3-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(C[NH+]1CCc3sccc3[C@H]1C)C2=O |
| InChI | InChI=1S/C18H25N3O2S/c1-12-3-7-18(8-4-12)16(22)21(17(23)19-18)11-20-9-5-15-14(13(20)2)6-10-24-15/h6,10,12-13H,3-5,7-9,11H2,1-2H3,(H,19,23)/p+1/t12?,13-,18?/m1/s1 |
| InChIKey | CFIATZBPFWZFQE-YNAXMUEKSA-O |
| XLogP | 1.71 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|