C18H26N3O2S+ — CID 9320644
3-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9320644) has the molecular formula C18H26N3O2S+ and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9320644 |
| Molecular Formula | C18H26N3O2S+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC[C@H]1c2ccsc2CC[NH+]1CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H25N3O2S/c1-2-14-13-7-11-24-15(13)6-10-20(14)12-21-16(22)18(19-17(21)23)8-4-3-5-9-18/h7,11,14H,2-6,8-10,12H2,1H3,(H,19,23)/p+1/t14-/m0/s1 |
| InChIKey | XQCASJPRUCTGTD-AWEZNQCLSA-O |
| XLogP | 1.85 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|