C20H24N3O2S+ — CID 9320591
(5R)-3-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9320591) has the molecular formula C20H24N3O2S+ and a molecular weight of 370.50 g/mol. Its IUPAC name is (5R)-3-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9320591 |
| Molecular Formula | C20H24N3O2S+ |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (5R)-3-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC[C@@H]1c2ccsc2CC[NH+]1CN1C(=O)N[C@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H23N3O2S/c1-3-16-15-10-12-26-17(15)9-11-22(16)13-23-18(24)20(2,21-19(23)25)14-7-5-4-6-8-14/h4-8,10,12,16H,3,9,11,13H2,1-2H3,(H,21,25)/p+1/t16-,20-/m1/s1 |
| InChIKey | HUYDEYDUQDWMEL-OXQOHEQNSA-O |
| XLogP | 2.06 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|