C23H30N4O2+2 — CID 9171566
(5R)-5-methyl-3-[[4-[(3-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 9171566) has the molecular formula C23H30N4O2+2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (5R)-5-methyl-3-[[4-[(3-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[[4-[(3-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9171566 |
| Molecular Formula | C23H30N4O2+2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (5R)-5-methyl-3-[[4-[(3-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(C[NH+]2CC[NH+](CN3C(=O)N[C@](C)(c4ccccc4)C3=O)CC2)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-18-7-6-8-19(15-18)16-25-11-13-26(14-12-25)17-27-21(28)23(2,24-22(27)29)20-9-4-3-5-10-20/h3-10,15H,11-14,16-17H2,1-2H3,(H,24,29)/p+2/t23-/m1/s1 |
| InChIKey | QTDLPEIVISGNMA-HSZRJFAPSA-P |
| XLogP | -0.30 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|