C22H26N3O3S+ — CID 11939141
(5S)-3-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 11939141) has the molecular formula C22H26N3O3S+ and a molecular weight of 412.54 g/mol. Its IUPAC name is (5S)-3-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11939141 |
| Molecular Formula | C22H26N3O3S+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (5S)-3-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc([C@]2(C)NC(=O)N(C[NH+]3CCc4sccc4[C@@H]3C3CC3)C2=O)c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-22(15-4-3-5-16(12-15)28-2)20(26)25(21(27)23-22)13-24-10-8-18-17(9-11-29-18)19(24)14-6-7-14/h3-5,9,11-12,14,19H,6-8,10,13H2,1-2H3,(H,23,27)/p+1/t19-,22-/m0/s1 |
| InChIKey | QDNXEFHOQNTQSI-UGKGYDQZSA-O |
| XLogP | 2.07 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|