C20H23N3O3S — CID 11925371
(5R)-5-(3-methoxyphenyl)-5-methyl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 11925371) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is (5R)-5-(3-methoxyphenyl)-5-methyl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-methoxyphenyl)-5-methyl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11925371 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (5R)-5-(3-methoxyphenyl)-5-methyl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1cccc([C@@]2(C)NC(=O)N(CN3CCC[C@@H]3c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-20(14-6-3-7-15(12-14)26-2)18(24)23(19(25)21-20)13-22-10-4-8-16(22)17-9-5-11-27-17/h3,5-7,9,11-12,16H,4,8,10,13H2,1-2H3,(H,21,25)/t16-,20-/m1/s1 |
| InChIKey | YDDIBWPGPBFYCQ-OXQOHEQNSA-N |
| XLogP | 3.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|