C18H19N2O2S+ — CID 9320406
1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione (PubChem CID 9320406) has the molecular formula C18H19N2O2S+ and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9320406 |
| Molecular Formula | C18H19N2O2S+ |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione |
| SMILES | CC[C@H]1c2ccsc2CC[NH+]1CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O2S/c1-2-14-12-8-10-23-16(12)7-9-19(14)11-20-15-6-4-3-5-13(15)17(21)18(20)22/h3-6,8,10,14H,2,7,9,11H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | FJMPBOISVOCMQR-AWEZNQCLSA-O |
| XLogP | 1.83 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|