C18H20N3O3S2+ — CID 9325254
1-propan-2-yl-3-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 9325254) has the molecular formula C18H20N3O3S2+ and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-propan-2-yl-3-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-propan-2-yl-3-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9325254 |
| Molecular Formula | C18H20N3O3S2+ |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-propan-2-yl-3-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | CC(C)N1C(=O)C(=O)N(C[NH+]2CCc3sccc3[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C18H19N3O3S2/c1-11(2)21-17(23)16(22)20(18(21)24)10-19-7-5-13-12(6-9-26-13)15(19)14-4-3-8-25-14/h3-4,6,8-9,11,15H,5,7,10H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | WNPHMGHZOHNRSI-OAHLLOKOSA-O |
| XLogP | 1.50 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|