C16H17F3N3O2S2+ — CID 9129457
2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 9129457) has the molecular formula C16H17F3N3O2S2+ and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9129457 |
| Molecular Formula | C16H17F3N3O2S2+ |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@H]1c1cccs1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O2S2/c17-16(18,19)9-20-15(24)21-13(23)8-22-5-3-11-10(4-7-26-11)14(22)12-2-1-6-25-12/h1-2,4,6-7,14H,3,5,8-9H2,(H2,20,21,23,24)/p+1/t14-/m0/s1 |
| InChIKey | DVHJMQRHNFXEMK-AWEZNQCLSA-O |
| XLogP | 1.73 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |