C22H25N2OS2+ — CID 9128893
2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 9128893) has the molecular formula C22H25N2OS2+ and a molecular weight of 397.59 g/mol. Its IUPAC name is 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9128893 |
| Molecular Formula | C22H25N2OS2+ |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[(4S)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C[NH+]2CCc3sccc3[C@H]2c2cccs2)c(C)c1 |
| InChI | InChI=1S/C22H24N2OS2/c1-14-11-15(2)21(16(3)12-14)23-20(25)13-24-8-6-18-17(7-10-27-18)22(24)19-5-4-9-26-19/h4-5,7,9-12,22H,6,8,13H2,1-3H3,(H,23,25)/p+1/t22-/m0/s1 |
| InChIKey | WWUDBJHCZXBQMI-QFIPXVFZSA-O |
| XLogP | 3.90 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |