C22H31N2OS+ — CID 9000098
N-[2,6-di(propan-2-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9000098) has the molecular formula C22H31N2OS+ and a molecular weight of 371.57 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9000098 |
| Molecular Formula | C22H31N2OS+ |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C[NH+]1CCc2sccc2[C@@H]1C |
| InChI | InChI=1S/C22H30N2OS/c1-14(2)17-7-6-8-18(15(3)4)22(17)23-21(25)13-24-11-9-20-19(16(24)5)10-12-26-20/h6-8,10,12,14-16H,9,11,13H2,1-5H3,(H,23,25)/p+1/t16-/m0/s1 |
| InChIKey | WMFSOKZGVAZKNK-INIZCTEOSA-O |
| XLogP | 4.14 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |