C16H17Cl2N2OS+ — CID 8999932
N-(2,3-dichlorophenyl)-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 8999932) has the molecular formula C16H17Cl2N2OS+ and a molecular weight of 356.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 8999932 |
| Molecular Formula | C16H17Cl2N2OS+ |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | C[C@H]1c2ccsc2CC[NH+]1CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2OS/c1-10-11-6-8-22-14(11)5-7-20(10)9-15(21)19-13-4-2-3-12(17)16(13)18/h2-4,6,8,10H,5,7,9H2,1H3,(H,19,21)/p+1/t10-/m0/s1 |
| InChIKey | ZAZNDLPFWXDXJN-JTQLQIEISA-O |
| XLogP | 3.20 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |