C20H23N2O5S+ — CID 9000301
dimethyl 5-[[2-[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 9000301) has the molecular formula C20H23N2O5S+ and a molecular weight of 403.48 g/mol. Its IUPAC name is dimethyl 5-[[2-[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9000301 |
| Molecular Formula | C20H23N2O5S+ |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | dimethyl 5-[[2-[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C[NH+]2CCc3sccc3[C@H]2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-12-16-5-7-28-17(16)4-6-22(12)11-18(23)21-15-9-13(19(24)26-2)8-14(10-15)20(25)27-3/h5,7-10,12H,4,6,11H2,1-3H3,(H,21,23)/p+1/t12-/m1/s1 |
| InChIKey | INOMRWGLOBQUCQ-GFCCVEGCSA-O |
| XLogP | 1.46 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |