C18H19ClN5OS+ — CID 9000462
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9000462) has the molecular formula C18H19ClN5OS+ and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9000462 |
| Molecular Formula | C18H19ClN5OS+ |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | C[C@H]1c2ccsc2CC[NH+]1CC(=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C18H18ClN5OS/c1-12-14-5-7-26-17(14)4-6-23(12)9-18(25)22-15-8-13(19)2-3-16(15)24-11-20-10-21-24/h2-3,5,7-8,10-12H,4,6,9H2,1H3,(H,22,25)/p+1/t12-/m0/s1 |
| InChIKey | QTAHCXZXCWWKAU-LBPRGKRZSA-O |
| XLogP | 2.12 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |