C20H21ClN5OS+ — CID 9002580
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9002580) has the molecular formula C20H21ClN5OS+ and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9002580 |
| Molecular Formula | C20H21ClN5OS+ |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@@H]1C1CC1)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C20H20ClN5OS/c21-14-3-4-17(26-12-22-11-23-26)16(9-14)24-19(27)10-25-7-5-18-15(6-8-28-18)20(25)13-1-2-13/h3-4,6,8-9,11-13,20H,1-2,5,7,10H2,(H,24,27)/p+1/t20-/m0/s1 |
| InChIKey | CLSHFZUSMYHOJL-FQEVSTJZSA-O |
| XLogP | 2.51 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |