C18H19Cl2N2OS+ — CID 9002026
2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,5-dichlorophenyl)acetamide (PubChem CID 9002026) has the molecular formula C18H19Cl2N2OS+ and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 9002026 |
| Molecular Formula | C18H19Cl2N2OS+ |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@@H]1C1CC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2OS/c19-12-3-4-14(20)15(9-12)21-17(23)10-22-7-5-16-13(6-8-24-16)18(22)11-1-2-11/h3-4,6,8-9,11,18H,1-2,5,7,10H2,(H,21,23)/p+1/t18-/m0/s1 |
| InChIKey | HHGXIDUTQGCLJN-SFHVURJKSA-O |
| XLogP | 3.59 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |