C22H28N3O2S+ — CID 9002585
2-[[2-[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 9002585) has the molecular formula C22H28N3O2S+ and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[[2-[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[2-[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9002585 |
| Molecular Formula | C22H28N3O2S+ |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[[2-[(4R)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)C[NH+]2CCc3sccc3[C@H]2C2CC2)c1C |
| InChI | InChI=1S/C22H27N3O2S/c1-14-4-3-5-18(15(14)2)24-20(26)12-23-21(27)13-25-10-8-19-17(9-11-28-19)22(25)16-6-7-16/h3-5,9,11,16,22H,6-8,10,12-13H2,1-2H3,(H,23,27)(H,24,26)/p+1/t22-/m1/s1 |
| InChIKey | DSFVILNNPCYBKB-JOCHJYFZSA-O |
| XLogP | 2.01 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |