C20H22N3OS2+ — CID 9002304
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9002304) has the molecular formula C20H22N3OS2+ and a molecular weight of 384.55 g/mol. Its IUPAC name is N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9002304 |
| Molecular Formula | C20H22N3OS2+ |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | N#Cc1c(NC(=O)C[NH+]2CCc3sccc3[C@@H]2C2CC2)sc2c1CCC2 |
| InChI | InChI=1S/C20H21N3OS2/c21-10-15-13-2-1-3-17(13)26-20(15)22-18(24)11-23-8-6-16-14(7-9-25-16)19(23)12-4-5-12/h7,9,12,19H,1-6,8,11H2,(H,22,24)/p+1/t19-/m0/s1 |
| InChIKey | NBOZDFMNLKNJMT-IBGZPJMESA-O |
| XLogP | 2.70 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |