C19H21N2O3S+ — CID 9002061
N-(1,3-benzodioxol-5-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide (PubChem CID 9002061) has the molecular formula C19H21N2O3S+ and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 9002061 |
| Molecular Formula | C19H21N2O3S+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]acetamide |
| SMILES | O=C(C[NH+]1CCc2sccc2[C@@H]1C1CC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O3S/c22-18(20-13-3-4-15-16(9-13)24-11-23-15)10-21-7-5-17-14(6-8-25-17)19(21)12-1-2-12/h3-4,6,8-9,12,19H,1-2,5,7,10-11H2,(H,20,22)/p+1/t19-/m0/s1 |
| InChIKey | MDGGJHJZQOSBIL-IBGZPJMESA-O |
| XLogP | 2.01 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |