C16H17F3N3O3S+ — CID 9323079
1-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione (PubChem CID 9323079) has the molecular formula C16H17F3N3O3S+ and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9323079 |
| Molecular Formula | C16H17F3N3O3S+ |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CC(F)(F)F)C(=O)N1C[NH+]1CCc2sccc2[C@@H]1C1CC1 |
| InChI | InChI=1S/C16H16F3N3O3S/c17-16(18,19)7-21-13(23)14(24)22(15(21)25)8-20-5-3-11-10(4-6-26-11)12(20)9-1-2-9/h4,6,9,12H,1-3,5,7-8H2/p+1/t12-/m0/s1 |
| InChIKey | WZNJYIWVKNHOSZ-LBPRGKRZSA-O |
| XLogP | 0.95 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|