C19H20N3O4S+ — CID 9321727
1-(4-methoxyphenyl)-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 9321727) has the molecular formula C19H20N3O4S+ and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-methoxyphenyl)-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9321727 |
| Molecular Formula | C19H20N3O4S+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(N2C(=O)C(=O)N(C[NH+]3CCc4sccc4[C@@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-15-8-10-27-16(15)7-9-20(12)11-21-17(23)18(24)22(19(21)25)13-3-5-14(26-2)6-4-13/h3-6,8,10,12H,7,9,11H2,1-2H3/p+1/t12-/m0/s1 |
| InChIKey | GHONRPGUSBAJHK-LBPRGKRZSA-O |
| XLogP | 1.21 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|