C18H22N3O6+ — CID 9236291
methyl 1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate (PubChem CID 9236291) has the molecular formula C18H22N3O6+ and a molecular weight of 376.39 g/mol. Its IUPAC name is methyl 1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9236291 |
| Molecular Formula | C18H22N3O6+ |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | methyl 1-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CN2C(=O)C(=O)N(c3ccc(OC)cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H21N3O6/c1-26-14-5-3-13(4-6-14)21-16(23)15(22)20(18(21)25)11-19-9-7-12(8-10-19)17(24)27-2/h3-6,12H,7-11H2,1-2H3/p+1 |
| InChIKey | BMTREKUWKFTZLQ-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|