C19H23N3O5 — CID 7888420
1-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 7888420) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7888420 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(=O)N3C[C@@H](C)C[C@H](C)C3)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-12-8-13(2)10-20(9-12)16(23)11-21-17(24)18(25)22(19(21)26)14-4-6-15(27-3)7-5-14/h4-7,12-13H,8-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ACRBBLZRKIRNMV-STQMWFEESA-N |
| XLogP | 1.49 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|