C23H28N6O3 — CID 95808184
8-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-10-(4-methoxyphenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one (PubChem CID 95808184) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 8-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-10-(4-methoxyphenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one.
| Compound Name | 8-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-10-(4-methoxyphenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one |
|---|---|
| PubChem CID | 95808184 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 8-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-10-(4-methoxyphenyl)-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-7-one |
| SMILES | COc1ccc(-n2ncc3c2N(CC(=O)N2C[C@@H](C)C[C@H](C)C2)C(=O)N2CCN=C32)cc1 |
| InChI | InChI=1S/C23H28N6O3/c1-15-10-16(2)13-26(12-15)20(30)14-28-22-19(21-24-8-9-27(21)23(28)31)11-25-29(22)17-4-6-18(32-3)7-5-17/h4-7,11,15-16H,8-10,12-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | UTWMFRMBJOORKB-HOTGVXAUSA-N |
| XLogP | 2.39 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |