C24H24N6O3 — CID 46952558
N-[(4-methoxyphenyl)methyl]-2-(8-oxo-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl)acetamide (PubChem CID 46952558) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(8-oxo-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(8-oxo-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl)acetamide |
|---|---|
| PubChem CID | 46952558 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(8-oxo-5-phenyl-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C(=O)N3CCCN=C3c3cnn(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C24H24N6O3/c1-33-19-10-8-17(9-11-19)14-26-21(31)16-29-23-20(22-25-12-5-13-28(22)24(29)32)15-27-30(23)18-6-3-2-4-7-18/h2-4,6-11,15H,5,12-14,16H2,1H3,(H,26,31) |
| InChIKey | YGUVBAGFCQAAOW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |