C24H24N6O3 — CID 92558569
N-[(3-methoxyphenyl)methyl]-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide (PubChem CID 92558569) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 92558569 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide |
| SMILES | COc1cccc(CNC(=O)CN2C(=O)N3CCN=C3c3cnn(-c4ccc(C)cc4)c32)c1 |
| InChI | InChI=1S/C24H24N6O3/c1-16-6-8-18(9-7-16)30-23-20(14-27-30)22-25-10-11-28(22)24(32)29(23)15-21(31)26-13-17-4-3-5-19(12-17)33-2/h3-9,12,14H,10-11,13,15H2,1-2H3,(H,26,31) |
| InChIKey | ZWPOMCKIXZRZRT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |