C18H12F2N2O5 — CID 8597488
1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 8597488) has the molecular formula C18H12F2N2O5 and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8597488 |
| Molecular Formula | C18H12F2N2O5 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(=O)c3ccc(F)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H12F2N2O5/c1-27-12-5-3-11(4-6-12)22-17(25)16(24)21(18(22)26)9-15(23)10-2-7-13(19)14(20)8-10/h2-8H,9H2,1H3 |
| InChIKey | QCHGWHAGWPGRQU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|