C15H14F2N2O4 — CID 7837485
1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione (PubChem CID 7837485) has the molecular formula C15H14F2N2O4 and a molecular weight of 324.28 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7837485 |
| Molecular Formula | C15H14F2N2O4 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C15H14F2N2O4/c1-8(2)6-18-13(21)14(22)19(15(18)23)7-12(20)9-3-4-10(16)11(17)5-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | PEXOSBFTGJVBGZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|