C13H13F2NO2 — CID 62050662
1-[2-(3,4-difluorophenyl)-2-oxoethyl]piperidin-4-one (PubChem CID 62050662) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-2-oxoethyl]piperidin-4-one.
| Compound Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]piperidin-4-one |
|---|---|
| PubChem CID | 62050662 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-2-oxoethyl]piperidin-4-one |
| SMILES | O=C1CCN(CC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H13F2NO2/c14-11-2-1-9(7-12(11)15)13(18)8-16-5-3-10(17)4-6-16/h1-2,7H,3-6,8H2 |
| InChIKey | RSUUQTPYAYKSDD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |