C15H19F2NO2 — CID 107405385
1-(3,4-difluorophenyl)-2-(4-hydroxy-4-methylazepan-1-yl)ethanone (PubChem CID 107405385) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(4-hydroxy-4-methylazepan-1-yl)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(4-hydroxy-4-methylazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 107405385 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(4-hydroxy-4-methylazepan-1-yl)ethanone |
| SMILES | CC1(O)CCCN(CC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H19F2NO2/c1-15(20)5-2-7-18(8-6-15)10-14(19)11-3-4-12(16)13(17)9-11/h3-4,9,20H,2,5-8,10H2,1H3 |
| InChIKey | QSPVZVPSVSQIEB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |