C12H13F2NO2S — CID 54976721
1-(3,4-difluorophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 54976721) has the molecular formula C12H13F2NO2S and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 54976721 |
| Molecular Formula | C12H13F2NO2S |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | O=C(CN1CCS(=O)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO2S/c13-10-2-1-9(7-11(10)14)12(16)8-15-3-5-18(17)6-4-15/h1-2,7H,3-6,8H2 |
| InChIKey | PRJXWZYNTIXVRV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |