C12H10F2N2O3 — CID 60624816
3-[2-(3,4-difluorophenyl)-2-oxoethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 60624816) has the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenyl)-2-oxoethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(3,4-difluorophenyl)-2-oxoethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60624816 |
| Molecular Formula | C12H10F2N2O3 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[2-(3,4-difluorophenyl)-2-oxoethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CC(=O)c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C12H10F2N2O3/c1-15-6-11(18)16(12(15)19)5-10(17)7-2-3-8(13)9(14)4-7/h2-4H,5-6H2,1H3 |
| InChIKey | WDWHXTGOVXXDLU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|