C14H13FN2O5 — CID 7549299
1-ethyl-3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 7549299) has the molecular formula C14H13FN2O5 and a molecular weight of 308.27 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-ethyl-3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7549299 |
| Molecular Formula | C14H13FN2O5 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)c2ccc(OC)c(F)c2)C1=O |
| InChI | InChI=1S/C14H13FN2O5/c1-3-16-12(19)13(20)17(14(16)21)7-10(18)8-4-5-11(22-2)9(15)6-8/h4-6H,3,7H2,1-2H3 |
| InChIKey | UTEXRZYEOFGMAB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|